PRODUCT Properties
| Boiling point: | 198 °C0.08 mm Hg(lit.) |
| Density | 0.905±0.06 g/cm3(Predicted) |
| Flash point: | 62 °C |
| storage temp. | -20°C |
| solubility | 0.15 M Tris-HCl pH 8.5: >1 mg/ml (from Oleic Acid); DMF: >100 mg/ml (from Oleic Acid); DMSO: >100 mg/ml (from Oleic Acid); Ethanol: >100 mg/ml (from Oleic Acid); PBS pH 7.2: <100 μg/ml (from Oleic Acid) |
| pka | 4.78±0.10(Predicted) |
| form | liquid |
| color | Colorless to light yellow |
| biological source | plant |
| Major Application | food and beverages |
| InChI | 1S/C20H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10H,2-5,8,11-19H2,1H3,(H,21,22)/b7-6-,10-9- |
| InChIKey | XSXIVVZCUAHUJO-HZJYTTRNSA-N |
| SMILES | CCCCC\C=C/C\C=C/CCCCCCCCCC(O)=O |
| CAS DataBase Reference | 2091-39-6(CAS DataBase Reference) |
Description and Uses
11,14-Eicosadienoic Acid is studied in metabolic profiling of human colorectal cancer.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P264-P280-P303+P361+P353-P305+P351+P338-P337+P313-P370+P378-P403+P235-P501 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
