S955777
4-(2-Keto-1-benzimidazolinyl)piperidine , 98% , 20662-53-7
CAS NO.：20662-53-7
Empirical Formula: C12H15N3O
Molecular Weight: 217.27
MDL number: MFCD00005714
EINECS: 243-950-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB496.86 | In Stock |
|
| 5g | RMB1705.07 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C (lit.) |
| Boiling point: | 357.82°C (rough estimate) |
| Density | 1.1005 (rough estimate) |
| refractive index | 1.5290 (estimate) |
| storage temp. | 2-8°C, protect from light |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.06±0.30(Predicted) |
| form | Powder |
| color | Off-white to slightly yellow |
| InChI | InChI=1S/C12H15N3O/c16-12-14-10-3-1-2-4-11(10)15(12)9-5-7-13-8-6-9/h1-4,9,13H,5-8H2,(H,14,16) |
| InChIKey | BYNBAMHAURJNTR-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C2CCNCC2)C2=CC=CC=C2N1 |
| CAS DataBase Reference | 20662-53-7(CAS DataBase Reference) |
Description and Uses
4-(2-Keto-1-benzimidazolinyl)piperidine was used to study the structure–activity relationships with several potent and selective analogues.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29333999 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
