T3380131
Bis(diisopropylamino)chlorophosphine , >97.0%(T) , 56183-63-2
Synonym(s):
Chlorobis(N,N-diisopropyl)phosphoramidite;Chlorobis(N,N-diisopropylamino)phosphine;Tetraisopropylphosphorodiamidous chloride
| Pack Size | Price | Stock | Quantity |
| 5g | RMB792.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-104 °C(lit.) |
| Boiling point: | 291℃ |
| Flash point: | 130℃ |
| storage temp. | Store under inert gas |
| pka | 4.50±0.70(Predicted) |
| form | Powder |
| color | white to off-white |
| Sensitive | air sensitive, moisture sensitive |
| InChI | InChI=1S/C12H28ClN2P/c1-9(2)14(10(3)4)16(13)15(11(5)6)12(7)8/h9-12H,1-8H3 |
| InChIKey | FEHUTHGOLLQBNW-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(N(C(C)C)C(C)C)Cl |
| CAS DataBase Reference | 56183-63-2(CAS DataBase Reference) |
Description and Uses
Bis(diisopropylamino)chlorophosphine is a white to off-white powder to crystalline organophosphorus compound, mainly used as an organic synthetic raw material or reaction reagent. It can be used in the synthesis of mixed phosphorothioate and methylenephosphine derivatives, etc. It is commonly used in chemical production and laboratory research.
Bis(diisopropylamino)chlorophosphine has been used in the synthesis of tert-butyl tetraisopropylphosphorodiamidite ligand for palladium-catalyzed Buchwald–Hartwig amination reaction.
It is also can be used to synthesize:
- acyclic N-phosphonio imine catalyst for selective epoxidations
- boryl-substituted methylenephosphonium derivatives
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 1 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310099 |





