PRODUCT Properties
| Boiling point: | 55-57 °C0.2 mm Hg(lit.) |
| Density | 1.002 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 214 °F |
| solubility | Chloroform (Sparingly) |
| form | Liquid |
| pka | 3.96±0.70(Predicted) |
| color | Clear colorless to light yellow |
| Sensitive | Air & Moisture Sensitive |
| Stability: | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C8H20ClN2P/c1-5-10(6-2)12(9)11(7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | JVEHJSIFWIIFHM-UHFFFAOYSA-N |
| SMILES | P(N(CC)CC)(N(CC)CC)Cl |
| CAS DataBase Reference | 685-83-6(CAS DataBase Reference) |
Description and Uses
Bis(diethylamino)chlorophosphine is an intermediate in synthesizing Toldimfos Sodium (T535270), a cattle drug that can be used to investigate the bovine serum paraoxonase 1 (PON1) activity.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 23-26-36-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29299090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |





