T3479831
6-Methoxytryptamine , >98.0%(T)(HPLC) , 3610-36-4
Synonym(s):
3-(2-Aminoethyl)-6-methoxyindole
CAS NO.：3610-36-4
Empirical Formula: C11H14N2O
Molecular Weight: 190.24
MDL number: MFCD00005663
EINECS: 222-778-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB336.00 | In Stock |
|
| 500mg | RMB1320.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-147 °C(lit.) |
| Boiling point: | 325.75°C (rough estimate) |
| Density | 1.0815 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | 2-8°C |
| form | crystalline |
| pka | 17.43±0.30(Predicted) |
| color | yellow |
| Water Solubility | MODERATELY SOLUBLE |
| InChI | InChI=1S/C11H14N2O/c1-14-9-2-3-10-8(4-5-12)7-13-11(10)6-9/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | ANTAOYZCCFNXOG-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(OC)=C2)C(CCN)=C1 |
| CAS DataBase Reference | 3610-36-4(CAS DataBase Reference) |
Description and Uses
6-Methoxytryptamine can be useful in the preparation of harmine derivatives and tetrahydro-β-carbolines with potential antibacterial activity.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H317-H314 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 43-34 |
| Safety Statements | 45-36/37/39-26 |
| WGK Germany | 3 |
| HS Code | 29339980 |
