T3538031
Tetrakis(2-ethylhexyl) Orthosilicate , >97.0%(GC) , 115-82-2
CAS NO.：115-82-2
Empirical Formula: C32H68O4Si
Molecular Weight: 544.97
MDL number: MFCD00015263
EINECS: 204-109-6
| Pack Size | Price | Stock | Quantity |
| 5mL | RMB112.00 | In Stock |
|
| 25mL | RMB392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-73°C |
| Boiling point: | 194 °C |
| Density | 0.88 |
| refractive index | 1.4388 |
| Flash point: | 188°C |
| form | liquid |
| Specific Gravity | 0.88 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C32H68O4Si/c1-9-17-21-29(13-5)25-33-37(34-26-30(14-6)22-18-10-2,35-27-31(15-7)23-19-11-3)36-28-32(16-8)24-20-12-4/h29-32H,9-28H2,1-8H3 |
| InChIKey | MQHSFMJHURNQIE-UHFFFAOYSA-N |
| SMILES | [Si](OCC(CC)CCCC)(OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC |
| EPA Substance Registry System | Silicic acid (H4SiO4), tetrakis(2-ethylhexyl) ester (115-82-2) |
Description and Uses
Synthetic lubricants and functional fluids.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362+P364-P403+P233-P501c |
| Safety Statements | 23-24/25 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
