![4-Amino-1-[2-(4-methoxyphenyl)ethyl]piperidine](https://img.chemicalbook.com/CAS/GIF/85098-70-0.gif)
T7611730
4-Amino-1-[2-(4-methoxyphenyl)ethyl]piperidine , >98.0%(T)(HPLC) , 85098-70-0
CAS NO.：85098-70-0
Empirical Formula: C14H22N2O
Molecular Weight: 234.34
MDL number: MFCD01631147
EINECS: 285-422-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB392.00 | In Stock |
|
| 25g | RMB1272.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-32 °C |
| Boiling point: | 346.6±37.0 °C(Predicted) |
| Density | 1.030±0.06 g/cm3(Predicted) |
| form | powder to crystal |
| pka | 10.49±0.20(Predicted) |
| color | White to Yellow to Orange |
| InChI | 1S/C14H22N2O/c1-17-14-4-2-12(3-5-14)6-9-16-10-7-13(15)8-11-16/h2-5,13H,6-11,15H2,1H3 |
| InChIKey | HTGMIBQQTLUEKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN2CCC(N)CC2)cc1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313-P362 |
| WGK Germany | WGK 3 |
| HS Code | 2933.39.9200 |
| Storage Class | 11 - Combustible Solids |
