PRODUCT Properties
| Melting point: | 80-86 °C |
| Boiling point: | 120 °C / 1mmHg |
| Density | 1.603±0.06 g/cm3(Predicted) |
| solubility | almost transparency in hot Toluene |
| pka | 3.04±0.46(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1793118 |
| InChI | 1S/C4HF6NO2/c5-3(6,7)1(12)11-2(13)4(8,9)10/h(H,11,12,13) |
| InChIKey | GMQVFHZSXKJCIV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=O)NC(=O)C(F)(F)F |
| CAS DataBase Reference | 407-24-9(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorodiacetamide (407-24-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 36/37/38-36/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |





