PRODUCT Properties
| Melting point: | 60-85° (softens about 55°); mp 88-91° (softens about 75°) |
| Boiling point: | 463.7±28.0 °C(Predicted) |
| Density | 1.439±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Merck | 14,1071 |
| InChI | InChI=1S/C12H10O5S2/c13-18(14,11-7-3-1-4-8-11)17-19(15,16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | MLWPJXZKQOPTKZ-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(OS(=O)(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
In Friedel-Crafts sulfone synthesis; in other sulfonylation reactions.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H314 |
| Precautionary statements | P234-P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| RIDADR | 3261 |
| HS Code | 2904.10.3700 |
| HazardClass | 8 |
| PackingGroup | III |
