T8185630
Cryptocyanine , >98.0%(HPLC) , 4727-50-8
Synonym(s):
Cryptocyanine;Kryptocyanine
CAS NO.:4727-50-8
Empirical Formula: C25H25IN2
Molecular Weight: 480.38
MDL number: MFCD00011970
EINECS: 225-224-8
| Pack Size | Price | Stock | Quantity |
| 200mg | RMB336.00 | In Stock |
|
| 1g | RMB872.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250.5-253 °C(lit.) |
| Density | 1.3683 (estimate) |
| storage temp. | 0-6°C |
| solubility | soluble in Ethanol |
| form | Powder |
| color | Green |
| Sensitive | Light Sensitive |
| λmax | 648 nm 703 nm (2nd) |
| InChI | 1S/C25H25N2.HI/c1-3-26-18-16-20(22-12-5-7-14-24(22)26)10-9-11-21-17-19-27(4-2)25-15-8-6-13-23(21)25;/h5-19H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | CEJANLKHJMMNQB-UHFFFAOYSA-M |
| SMILES | [I-].CCN1C=CC(=C\C=C\c2cc[n+](CC)c3ccccc23)c4ccccc14 |
| CAS DataBase Reference | 4727-50-8(CAS DataBase Reference) |
| EPA Substance Registry System | Cryptocyanine iodide (4727-50-8) |
Description and Uses
Cryptocyanine is a fluorescent dye widely used in biomedicine for various applications. It can be utilized to label and track cells, proteins, and biomolecules in live cell imaging studies. Additionally, Cryptocyanine is employed in the detection and imaging of specific diseases, including cancer, due to its high selectivity and sensitivity.
Organic dye, soluble, used as a chemical shutter in laser operation.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+ |
| Risk Statements | 28-36/37/38 |
| Safety Statements | 26-28-36/37-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | VC3676880 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29334990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




