T8232630
1-Cyclopropylethanol , >98.0%(GC) , 765-42-4
Synonym(s):
α-Methylcyclopropanemethanol;Cyclopropyl methyl carbinol
CAS NO.：765-42-4
Empirical Formula: C5H10O
Molecular Weight: 86.13
MDL number: MFCD00001300
EINECS: 212-145-9
| Pack Size | Price | Stock | Quantity |
| 5mL | RMB300.00 | In Stock |
|
| 25mL | RMB912.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -32.1°C |
| Boiling point: | 120-122 °C(lit.) |
| Density | 0.881 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 87 °F |
| storage temp. | Flammables area |
| pka | 15.17±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1839704 |
| InChI | InChI=1S/C5H10O/c1-4(6)5-2-3-5/h4-6H,2-3H2,1H3 |
| InChIKey | DKKVKJZXOBFLRY-UHFFFAOYSA-N |
| SMILES | C(C1CC1)(O)C |
| CAS DataBase Reference | 765-42-4(CAS DataBase Reference) |
| EPA Substance Registry System | Cyclopropanemethanol, .alpha.-methyl- (765-42-4) |
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P370+P378-P403+P235-P501 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29061990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
