T8242830
1-(2-Chlorophenyl)piperazine , >98.0%(GC)(T) , 39512-50-0
CAS NO.：39512-50-0
Empirical Formula: C10H13ClN2
Molecular Weight: 196.68
MDL number: MFCD00040727
EINECS: 254-480-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB268.00 | In Stock |
|
| 25g | RMB720.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-154 °C |
| Boiling point: | 102-104°C 0,2mm |
| Density | 1.18 |
| refractive index | 1.5810-1.5850 |
| storage temp. | Store at Room Tem. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| pka | 8.81±0.10(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C10H13ClN2/c11-9-3-1-2-4-10(9)13-7-5-12-6-8-13/h1-4,12H,5-8H2 |
| InChIKey | PWZDJIUQHUGFRJ-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2Cl)CCNCC1 |
| CAS DataBase Reference | 39512-50-0(CAS DataBase Reference) |
Description and Uses
1-(2-Chlorophenyl)piperazine is a piperazine derivative useful in the treatment of cardiovascular and cerebrovascular diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2933.59.8000 |
