T8264930
N-Benzyloxycarbonyl-L-isoleucine , >98.0%(HPLC) , 3160-59-6
Synonym(s):
N-Carbobenzyloxy-L -isoleucine;Z-Ile-OH
CAS NO.：3160-59-6
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD00027064
EINECS: 221-611-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB176.00 | In Stock |
|
| 25g | RMB704.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54 °C(lit.) |
| alpha | 7 º (c=6, EtOH) |
| Boiling point: | 408.52°C (rough estimate) |
| Density | 1.1356 (rough estimate) |
| refractive index | 6.5 ° (C=6, EtOH) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Ethanol (Sparingly), Methanol (Sparingly) |
| form | Off-White Semi-Solid |
| pka | 4.02±0.22(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| optical activity | [α]20/D +6.0°, c = 6 in ethanol |
| BRN | 4189486 |
| InChI | InChI=1S/C14H19NO4/c1-3-10(2)12(13(16)17)15-14(18)19-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,15,18)(H,16,17)/t10-,12-/m0/s1 |
| InChIKey | JSHXJPFZKBRLFU-JQWIXIFHSA-N |
| SMILES | C(O)(=O)[C@H]([C@@H](C)CC)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 3160-59-6(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-isoleucine is an N-Cbz-protected form of L-Isoleucine (I820175). L-Isoleucine is classified as an essential amino acid, and is also a tumour promoter of bladder cancer in rats.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29242990 |
