PRODUCT Properties
| Boiling point: | 96-97 °C (lit.) |
| Density | 1.395 g/mL at 25 °C (lit.) |
| refractive index | 1.347 |
| Flash point: | None |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | clear liquid |
| Specific Gravity | 1.395 |
| color | Colorless to Almost colorless |
| Water Solubility | Slightly Soluble in water. (1.4 g/L) (25°C) |
| Sensitive | Lachrymatory |
| BRN | 1912832 |
| InChI | InChI=1S/C4Cl2F4O3/c5-3(7,8)1(11)13-2(12)4(6,9)10 |
| InChIKey | VBJIFLOSOQGDRZ-UHFFFAOYSA-N |
| SMILES | O(C(=O)C(F)(F)Cl)C(=O)C(F)(F)Cl |
| CAS DataBase Reference | 2834-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, chlorodifluoro-, anhydride (2834-23-3) |
Description and Uses
Chlorodifluoroacetic anhydride has been used:
- for dual element acetylation tagging derivatization of amines by using microwave sustained helium emission detector
- as derivatization reagent in determination of estrone and 17β-estradiol in hair by GC-MS
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H314 |
| Precautionary statements | P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P362+P364 |
| Hazard Codes | C |
| Risk Statements | 23/24/25-34-21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2915907098 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
