PRODUCT Properties
| Melting point: | 200 °C |
| Boiling point: | 480.3±45.0 °C(Predicted) |
| Density | 1.371±0.06 g/cm3(Predicted) |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 8.65±0.40(Predicted) |
| Colour Index | 37550 |
| color | White to Amber |
| InChI | InChI=1S/C19H16ClNO4/c1-24-17-10-18(25-2)15(9-14(17)20)21-19(23)13-7-11-5-3-4-6-12(11)8-16(13)22/h3-10,22H,1-2H3,(H,21,23) |
| InChIKey | XDWATWCCUTYUDE-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(O)=C1C(NC1=CC(Cl)=C(OC)C=C1OC)=O |
| CAS DataBase Reference | 92-72-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthalenecarboxamide, n-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy-(92-72-8) |
| EPA Substance Registry System | 2-Naphthalenecarboxamide, N-(5-chloro-2,4-dimethoxyphenyl)-3-hydroxy- (92-72-8) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H335-H400-H372 |
| Precautionary statements | P261-P273-P280-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 2924.29.7790 |






