T8349330
1,2,3,4-Cyclobutanetetracarboxylic Acid , >98.0%(GC)(T) , 53159-92-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242 °C (dec.) (lit.) |
| Boiling point: | 439.2±45.0 °C(Predicted) |
| Density | 1.934±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | methanol: soluble10mg/mL, clear, colorless to light yellow |
| form | Solid |
| pka | 3.03±0.70(Predicted) |
| color | Off-White |
| InChI | 1S/C8H8O8/c9-5(10)1-2(6(11)12)4(8(15)16)3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16) |
| InChIKey | CURBACXRQKTCKZ-UHFFFAOYSA-N |
| SMILES | OC(=O)C1C(C(C1C(O)=O)C(O)=O)C(O)=O |
Description and Uses
1,2,3,4-Cyclobutanetetracarboxylic acid was employed as capping ligand in the preparation of gold colloids.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| HS Code | 2917.20.0000 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






