T8496630
2,4-Dichloronitrobenzene , >99.0%(GC) , 611-06-3
Synonym(s):
1,3-Dichloro-4-nitrobenzene;2,4-Dichloro-1-nitrobenzene, 1-Nitro-2.4-dichlorine benzene;asym.-Nitro-m-dichlorobenzene
CAS NO.:611-06-3
Empirical Formula: C6H3Cl2NO2
Molecular Weight: 192
MDL number: MFCD00007071
EINECS: 210-248-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-32 °C(lit.) |
| Boiling point: | 258 °C(lit.) |
| Density | 1.479 |
| vapor pressure | 0.013 hPa (20 °C) |
| refractive index | 1.5512 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | 188g/l |
| form | Crystalline Low Melting Solid |
| color | Yellow-brown |
| Water Solubility | 188 mg/L (20 ºC) |
| BRN | 1451655 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C6H3Cl2NO2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H |
| InChIKey | QUIMTLZDMCNYGY-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Cl)cc1Cl |
| CAS DataBase Reference | 611-06-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2,4-dichloro-1-nitro-(611-06-3) |
| IARC | 2B (Vol. 123) 2020 |
| EPA Substance Registry System | 2,4-Dichloronitrobenzene (611-06-3) |
Description and Uses
2,4-Dichloro-1-nitrobenzene is used as a reagent in the synthesis of the hepatitis C virus polymerase inhibitor, Deleobuvir (BI 207127).
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H311-H317-H341-H350-H411 |
| Precautionary statements | P202-P273-P280-P301+P312-P302+P352+P312-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-43-21/22 |
| Safety Statements | 26-36-61-36/37-24 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | CZ5420000 |
| Autoignition Temperature | 500 °C |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Aquatic Chronic 2 Carc. 1B Muta. 2 Skin Sens. 1B |
| Hazardous Substances Data | 611-06-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 380 mg/kg LD50 dermal Rat 920 mg/kg |







