T8669830
6'-(Diethylamino)-1',2'-benzofluoran , >98.0%(GC)(T) , 26628-47-7
CAS NO.：26628-47-7
Empirical Formula: C28H23NO3
Molecular Weight: 421.49
MDL number: MFCD00480357
EINECS: 247-853-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 221 °C |
| Boiling point: | 642.4±55.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| pka | 5.05±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C28H23NO3/c1-3-29(4-2)19-14-15-23-25(17-19)31-24-16-13-18-9-5-6-10-20(18)26(24)28(23)22-12-8-7-11-21(22)27(30)32-28/h5-17H,3-4H2,1-2H3 |
| InChIKey | HMNGPLGXLQFPFN-UHFFFAOYSA-N |
| SMILES | C12(C3=C(C=CC=C3)C(=O)O1)C1=C(C=C(N(CC)CC)C=C1)OC1=C2C2=CC=CC=C2C=C1 |
| EPA Substance Registry System | Spiro[12H-benzo[a]xanthene-12,1'(3'H)-isobenzofuran]-3'-one, 9-(diethylamino)- (26628-47-7) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| TSCA | TSCA listed |
| HS Code | 2932.99.7000 |
