T8823830
1,7-Dichloro-1,1,3,3,5,5,7,7-octamethyltetrasiloxane , >97.0%(GC) , 2474-02-4
CAS NO.：2474-02-4
Empirical Formula: C8H24Cl2O3Si4
Molecular Weight: 351.52
MDL number: MFCD00045148
EINECS: 219-597-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB572.00 | In Stock |
|
| 25g | RMB2000.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −62 °C(lit.) |
| Boiling point: | 222 °C(lit.) |
| Density | 1.011 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| form | liquid |
| Specific Gravity | 1.011 |
| color | Colorless to Almost colorless |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1784800 |
| InChI | 1S/C8H24Cl2O3Si4/c1-14(2,9)11-16(5,6)13-17(7,8)12-15(3,4)10/h1-8H3 |
| InChIKey | UHRAUGIQJXURFE-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)Cl |
| EPA Substance Registry System | Tetrasiloxane, 1,7-dichloro-1,1,3,3,5,5,7,7-octamethyl- (2474-02-4) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
