T8963030
Formaldehyde 2,4-Dinitrophenylhydrazone , >98.0%(T) , 1081-15-8
Synonym(s):
Formaldehyde-2,4-dinitrophenylhydrazone;Formaldehyde-2,4-DNPH Solution
CAS NO.:1081-15-8
Empirical Formula: C7H6N4O4
Molecular Weight: 210.15
MDL number: MFCD00191364
EINECS: 628-494-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB256.00 | In Stock |
|
| 10g | RMB896.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-156°C |
| Boiling point: | 357.8±52.0 °C(Predicted) |
| Density | 1.54±0.1 g/cm3(Predicted) |
| Flash point: | 2 °C |
| storage temp. | 0-6°C |
| solubility | Acetone (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 10.30±0.10(Predicted) |
| color | Light Yellow to Dark Orange |
| BRN | 750330 |
| Stability: | Light Sensitive, Shock Sensitive |
| Major Application | environmental |
| InChI | InChI=1S/C7H6N4O4/c1-8-9-6-3-2-5(10(12)13)4-7(6)11(14)15/h2-4,9H,1H2 |
| InChIKey | UEQLSLWCHGLSML-UHFFFAOYSA-N |
| SMILES | C=NNC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O |
Description and Uses
Formaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-36-20/21/22-11-22 |
| Safety Statements | 26-36/37/39-36-36/37-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| RTECS | AB2826500 |
| HS Code | 38220090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |






