T9274530
Disodium 2-Oxoglutarate , >98.0%(T) , 305-72-6
Synonym(s):
2-Oxoglutaric acid disodium salt;2-Oxopentanedioic acid disodium salt hydrate;Sodium α-ketoglutarate dibasic;Sodium 2-oxoglutarate dibasic hydrate
CAS NO.：305-72-6
Empirical Formula: C5H8Na2O7
Molecular Weight: 226.09
MDL number: MFCD00043347
EINECS: 206-167-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB96.00 | In Stock |
|
| 25g | RMB368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.824 at 20℃ |
| vapor pressure | 0.02Pa at 20-50℃ |
| storage temp. | 2-8°C |
| form | Crystalline Powder or Granules |
| color | White |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 5658566 |
| InChI | InChI=1S/C5H6O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | HSSWOFWCOAQLHZ-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)O[Na])CCC(=O)O[Na] |
| LogP | -1.07 at 23℃ and pH7 |
| Surface tension | 65.3mN/m at 1.02g/L and 20℃ |
| CAS DataBase Reference | 305-72-6(CAS DataBase Reference) |
Description and Uses
α-Ketoglutaric acid disodium salt dihydrate (2-Oxoglutaric acid disodium salt) may be used as starting reagent for the synthesis of deuteriated 2-oxo[3,3-2H2]glutarate disodium salt.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-24/25-45-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | SA0454700 |
| HS Code | 29171900 |
