T9478630
Methyl cis-11-Octadecenoate , >98.0%(GC) , 1937-63-9
Synonym(s):
cis-11-Octadecenoic methyl ester;cis-Vaccenic acid methyl ester
CAS NO.：1937-63-9
Empirical Formula: C19H36O2
Molecular Weight: 296.49
MDL number: MFCD00010457
EINECS: 217-714-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 136°C/0.2mmHg(lit.) |
| Density | 0.873±0.06 g/cm3(Predicted) |
| refractive index | 1.4500 to 1.4540 |
| Flash point: | 62 °C |
| storage temp. | −20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| BRN | 1911845 |
| InChI | 1S/C19H36O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h8-9H,3-7,10-18H2,1-2H3/b9-8- |
| InChIKey | PVVODBCDJBGMJL-HJWRWDBZSA-N |
| SMILES | CCCCCC\C=C/CCCCCCCCCC(=O)OC |
| LogP | 8.160 (est) |
Description and Uses
Vaccenic Acid methyl Ester is the methyl ester of Vaccenic Acid (V070000) which is a fatty acid found in Artemia salina that shows antimicrobial activity against a variety of microorganisms except Escherichia coli, Micrococcus luteus and Salmonella enteritidis.
Safety
| Symbol(GHS) |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H410 |
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN1206 - class 3 - PG 2 - Heptanes, solution |
| WGK Germany | 1 |
| F | 8-10-23 |
| HS Code | 2916.19.5000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
