PRODUCT Properties
| Melting point: | 27°C |
| Boiling point: | 159 °C |
| Density | 1,9 g/cm3 |
| Flash point: | 159°C |
| form | powder to lump |
| color | White to Almost white |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 29.0 to 33.0 ℃ |
| InChI | InChI=1S/C5H6O3/c6-5(7)4-2-1-3-8-4/h1-2,4H,3H2,(H,6,7) |
| InChIKey | OWIAIPIQXHPUHV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| CAS DataBase Reference | 558-96-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Bromoperfluorononane (558-96-3) |
Description and Uses
1-Bromoperfluorononane is a specialty product for proteomics research applications. It is also used as pharmaceutical intermediate and in chemical research.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P280g-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HS Code | 29037800 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





