PRODUCT Properties
| Melting point: | 220 °C |
| Boiling point: | 255.1±23.0 °C(Predicted) |
| Density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | Amber Vial, Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.55±0.20(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C3H6N4O2/c8-7(9)6-3-4-1-2-5-3/h1-2H2,(H2,4,5,6) |
| InChIKey | DJZWNSRUEJSEEB-UHFFFAOYSA-N |
| SMILES | C1(N[N+]([O-])=O)NCCN=1 |
| CAS DataBase Reference | 5465-96-3(CAS DataBase Reference) |
Description and Uses
2-Nitroamino-2-imidazoline is a neonicotinoid substituents that forms water bridge at nicotinic acetylcholine receptor.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933.29.9000 |
