PRODUCT Properties
| Melting point: | 126°C |
| Boiling point: | 155-158 °C(Press: 0.03 Torr) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 3.85±0.36(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C14H12O3/c15-14(16)13-9-5-4-6-11(13)10-17-12-7-2-1-3-8-12/h1-9H,10H2,(H,15,16) |
| InChIKey | YKNORODREYVARM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1COC1=CC=CC=C1 |
| CAS DataBase Reference | 724-98-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(Phenoxymethyl)benzoic acid(724-98-1) |
| EPA Substance Registry System | Benzoic acid, 2-(phenoxymethyl)- (724-98-1) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN3077 |
| TSCA | Yes |
| HS Code | 2918.99.4700 |
| HazardClass | 9 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
