PRODUCT Properties
| Melting point: | 108-110 °C(lit.) |
| Boiling point: | 235.3±35.0 °C(Predicted) |
| Density | 1.5096 (estimate) |
| storage temp. | Store at room temperature |
| solubility | 95% ethanol: soluble50mg/mL, clear, colorless to very faintly yellow |
| pka | 3.30±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2056612 |
| InChI | 1S/C8H3F5O2/c9-4-2(1-3(14)15)5(10)7(12)8(13)6(4)11/h1H2,(H,14,15) |
| InChIKey | LGCODSNZJOVMHV-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 653-21-4(CAS DataBase Reference) |
Description and Uses
2,3,4,5,6-Pentafluorophenylacetic acid has been used in the preparation of:
- 2,3,4,5,6-pentafluorophenylacetyl chloride
- 4-bromo-phenacyl-2,3,4,5,6-pentafluorophenyl acetate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
