T9937230
2-(p-Toluoyl)benzoic Acid , >98.0%(T) , 85-55-2
Synonym(s):
2-(4-Toluoyl)benzoic acid
CAS NO.:85-55-2
Empirical Formula: C15H12O3
Molecular Weight: 240.25
MDL number: MFCD00020287
EINECS: 201-614-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB196.00 | In Stock |
|
| 500g | RMB1464.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-139 °C(lit.) |
| Boiling point: | 342.97°C (rough estimate) |
| Density | 1.1783 (rough estimate) |
| refractive index | 1.5570 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | very soluble in Benzene,Ether,Acetone,Alcohol |
| form | powder to crystal |
| pka | 3.33±0.36(Predicted) |
| color | White to Almost white |
| Merck | 14,9539 |
| BRN | 2111078 |
| InChI | InChI=1S/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18) |
| InChIKey | ICQOWIXIHDDXDI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(C)C=C1 |
| CAS DataBase Reference | 85-55-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-(4-methylbenzoyl)-(85-55-2) |
| EPA Substance Registry System | Benzoic acid, 2-(4-methylbenzoyl)- (85-55-2) |
Description and Uses
2-(4-Methylbenzoyl)benzoic acid is used as a reactant in the coupling of benzoic and phenylacetic acids with aryltrifluoroborates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |





