A0484256
1-Thio-β-D-glucosetetraacetate , ≥98% , 19879-84-6
CAS NO.:19879-84-6
Empirical Formula: C14H20O9S
Molecular Weight: 364.37
MDL number: MFCD00063271
EINECS: 243-392-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB157.60 | In Stock |
|
| 1g | RMB492.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C(lit.) |
| Boiling point: | 425.5±45.0 °C(Predicted) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform, Dichloromethane, Ethyl Acetate |
| form | Solid |
| pka | 8.42±0.70(Predicted) |
| color | Colorless |
| optical activity | [α]20/D +5.8°, c = 2.2 in chloroform |
| Water Solubility | Soluble in water and chloroform (50 mg/ml). |
| BRN | 1440689 |
| InChI | InChI=1/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3/t10-,11-,12+,13-,14+/s3 |
| InChIKey | SFOZKJGZNOBSHF-RGDJUOJXSA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@H]1OC(=O)C)S |&1:0,5,10,12,18,r| |
| CAS DataBase Reference | 19879-84-6(CAS DataBase Reference) |
Description and Uses
1-thio-β-D-Glucose tetraacetate is a building block. It has been used in the synthesis of aromatic glucosinolates with anti-inflammatory activity, as well as glucosylated poly(pentafluorostyrene) derivatives for coating magnetic iron oxide nanoparticles.
A synthetic intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29329990 |



![1,3,4,6-Tetra-O-acetyl-2-deoxy-2-[(2-azidoacetyl)amino]-β-D-glucopyranose](https://img.chemicalbook.com/CAS/20211123/GIF/857677-98-6.gif)

