A0653356
4-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoicacid
Synonym(s):
γ-Maleimidobutyric acid;4-Maleimidobutanoic acid;N-(3-Carboxypropyl)maleimide;N-Maleoyl-4-aminobutyric acid;N-Maleoyl-GABA
CAS NO.:
Empirical Formula: C8H9NO4
Molecular Weight: 183.16
MDL number: MFCD00043139
EINECS: 611-461-8
| Pack Size | Price | Stock | Quantity |
| 500mg | RMB2275.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C |
| Boiling point: | 400.1±28.0 °C(Predicted) |
| Density | 1.395±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | 4.59±0.10(Predicted) |
| color | White to Pale Yellow |
| BRN | 1455876 |
| InChI | InChI=1S/C8H9NO4/c10-6-3-4-7(11)9(6)5-1-2-8(12)13/h3-4H,1-2,5H2,(H,12,13) |
| InChIKey | NCPQROHLJFARLL-UHFFFAOYSA-N |
| SMILES | N1(CCCC(O)=O)C(=O)C=CC1=O |
| CAS DataBase Reference | 57078-98-5(CAS DataBase Reference) |
Description and Uses
4-(2,5-dioxo-2H-pyrrol-1(5H)-yl)butanoic acid contains a maleimide group and a terminal carboxylic acid. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol.
- A short crosslinking reagent
- Modification reagent for thiol groups in proteins
- Maleimide Derivatives
- MTS & Sulfhydryl Active Reagents
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![<i>N</i>-Succinimidyl 4-Maleimidobutyrate [Cross-linking Reagent]](https://img.chemicalbook.com/CAS/GIF/80307-12-6.gif)

![<i>N</i>-Succinimidyl 3-Maleimidobenzoate [Cross-linking Reagent]](https://img.chemicalbook.com/CAS/GIF/58626-38-3.gif)

