A0655412
3'-Acetamidoacetophenone , 98% , 7463-31-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB79.20 | In Stock |
|
| 25G | RMB246.40 | In Stock |
|
| 100G | RMB806.40 | In Stock |
|
| 500G | RMB2226.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-130 °C |
| Boiling point: | 309.12°C (rough estimate) |
| Density | 1.1607 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| pka | 14.72±0.70(Predicted) |
| form | Solid |
| color | White |
| BRN | 2363443 |
| InChI | InChI=1S/C10H11NO2/c1-7(12)9-4-3-5-10(6-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
| InChIKey | AFZTYHRVDOKRKV-UHFFFAOYSA-N |
| SMILES | C(NC1=CC=CC(C(C)=O)=C1)(=O)C |
| CAS DataBase Reference | 7463-31-2(CAS DataBase Reference) |
Description and Uses
3'-Acetamidoacetophenone is used as an intermediate in the drug zaleplon.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29242990 |





