A0663312
H-Ala-OBzl.TosOH , 98% , 42854-62-6
CAS NO.：42854-62-6
Empirical Formula: C17H21NO5S
Molecular Weight: 351.42
MDL number: MFCD00066143
EINECS: 255-969-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB117.60 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-116 °C |
| alpha | -5 º (c=3% in methanol) |
| refractive index | -5.0 ° (C=3, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Methanol |
| form | Solid |
| color | White |
| optical activity | [α]20/D 5.0±0.5°, c = 3% in methanol |
| BRN | 3586474 |
| InChI | InChI=1/C10H13NO2.C7H8O3S/c1-8(11)10(12)13-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,8H,7,11H2,1H3;2-5H,1H3,(H,8,9,10)/t8-;/s3 |
| InChIKey | NWOPHJSSBMABBD-JNODIIHCNA-N |
| SMILES | C1(S(=O)(=O)O)=CC=C(C)C=C1.C1(=CC=CC=C1)COC(=O)[C@@H](N)C |&1:21,r| |
| CAS DataBase Reference | 42854-62-6(CAS DataBase Reference) |
Description and Uses
A benzoxazine derivatives as modulators of chemokine receptors for treatment of inflammatory and immunoregulatory diseases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-44-35-28-26-7-4 |
| WGK Germany | 3 |
| HS Code | 29224999 |
