A0680312
1-Acetylpiperazine , 99% , 13889-98-0
CAS NO.:13889-98-0
Empirical Formula: C6H12N2O
Molecular Weight: 128.17
MDL number: MFCD00058676
EINECS: 237-659-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB90.40 | In Stock |
|
| 100G | RMB317.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 31-34 °C (lit.) |
| Boiling point: | 127 °C |
| Density | 1.0754 (rough estimate) |
| refractive index | 1.4880 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | methanol: soluble1g/10 mL, clear, colorless to faintly greenish-yellow |
| form | Liquid After Melting |
| pka | 8.50±0.10(Predicted) |
| color | Clear light yellow |
| Water Solubility | Soluble in water 210 g/L (20°C). |
| Sensitive | Hygroscopic |
| BRN | 112220 |
| InChI | InChI=1S/C6H12N2O/c1-6(9)8-4-2-7-3-5-8/h7H,2-5H2,1H3 |
| InChIKey | PKDPUENCROCRCH-UHFFFAOYSA-N |
| SMILES | C(=O)(N1CCNCC1)C |
| CAS DataBase Reference | 13889-98-0(CAS DataBase Reference) |
Description and Uses
1-Acetylpiperazine may be used in the synthesis of series of 7-alkoxyl substituted indolizinoquinoline-5,12-dione derivatives and 2-substituted-N-(naphth-1-ylmethyl)-pyrimidin-4-amines and 2-substituted-N-benzhydrylpyrimidin-4-amines.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H314-H334-H335 |
| Precautionary statements | P261-P301+P312+P330-P303+P361+P353-P304+P340+P312-P305+P351+P338-P342+P311 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10-34 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








