A0860212
1-Adamantanemethylamine , >97.0%(GC) , 17768-41-1
CAS NO.:17768-41-1
Empirical Formula: C11H19N
Molecular Weight: 165.28
MDL number: MFCD00074750
EINECS: 241-752-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB79.20 | In Stock |
|
| 1G | RMB431.20 | In Stock |
|
| 5G | RMB1565.60 | In Stock |
|
| 25g | RMB6269.60 | In Stock |
|
| 100g | RMB7127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 83-85 °C/0.3 mmHg (lit.) |
| Density | 0.933 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 198 °F |
| storage temp. | 2-8°C(protect from light) |
| form | Liquid |
| pka | 10.71±0.29(Predicted) |
| color | Colorless to pale yellow |
| Sensitive | Air Sensitive |
| InChI | 1S/C11H19N/c12-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-7,12H2/t8-,9+,10-,11- |
| InChIKey | XSOHXMFFSKTSIT-BIBSGERRSA-N |
| SMILES | NCC12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
| CAS DataBase Reference | 17768-41-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Adamantanemethylamine(17768-41-1) |
Description and Uses
Adamantan-1-ylmethanamine (1-Aminomethyladamantane) is a Hyt hydrophobic group. Adamantan-1-ylmethanamine can be used in the synthesis of ZX782 (HY-161972)[1].
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | Xi,C |
| Risk Statements | 34 |
| Safety Statements | 24/25-45-36/37/39-27-26 |
| RIDADR | UN 2735 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HazardClass | 8 |
| HS Code | 29213000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





