A0890812
2-Amino-5-bromo-3-methylpyridine , >98.0% , 3430-21-5
CAS NO.:3430-21-5
Empirical Formula: C6H7BrN2
Molecular Weight: 187.04
MDL number: MFCD00068232
EINECS: 608-966-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB117.60 | In Stock |
|
| 100G | RMB912.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-95 °C(lit.) |
| Boiling point: | 250.0±35.0 °C(Predicted) |
| Density | 1.5672 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 4.96±0.49(Predicted) |
| color | Yellow |
| Sensitive | Hygroscopic |
| BRN | 386426 |
| InChI | InChI=1S/C6H7BrN2/c1-4-2-5(7)3-9-6(4)8/h2-3H,1H3,(H2,8,9) |
| InChIKey | KBLGGRWUEVCNPY-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1C |
| CAS DataBase Reference | 3430-21-5(CAS DataBase Reference) |
Description and Uses
2-Amino-5-bromo-3-methylpyridine may be used to synthesize:
- 5-bromo-2-chloro-3-methylpyridine
- 2-azidopyridine 1-oxide
- 2-amino-5-bromo-3-methylpyridine 1-oxide
- 2,5-dibromo-3-methyl pyridine
- ethyl-3,6-dibromo-8-methylimidazo[1,2-a]pyridine-2-carboxylate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![5-Bromo-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine](https://img.chemicalbook.com/CAS/GIF/115170-40-6.gif)
