A0898112
5-Aminoindan , ≥98.0% , 24425-40-9
Synonym(s):
5-Indanamine
CAS NO.:24425-40-9
Empirical Formula: C9H11N
Molecular Weight: 133.19
MDL number: MFCD00003803
EINECS: 246-241-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB79.20 | In Stock |
|
| 5G | RMB292.80 | In Stock |
|
| 25G | RMB1062.40 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 34-36 °C(lit.) |
| Boiling point: | 247-249 °C745 mm Hg(lit.) |
| Density | 0.9222 (rough estimate) |
| refractive index | 1.4600 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 0-10°C |
| pka | 5.17±0.20(Predicted) |
| form | Crystalline Solid |
| color | Brown |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 2082278 |
| InChI | InChI=1S/C9H11N/c10-9-5-4-7-2-1-3-8(7)6-9/h4-6H,1-3,10H2 |
| InChIKey | LEWZOBYWGWKNCK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(N)C=C2)CC1 |
| CAS DataBase Reference | 24425-40-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Aminoindan(24425-40-9) |
Description and Uses
5-Aminoindan was used in the synthesis of ligand 18/18 (2-(5-aminoindan)-6-(5-aminoindan)-4-chloro-s-triazine).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36-36/37 |
| WGK Germany | 3 |
| PackingGroup | III |
| HS Code | 29214900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |







