A1091112
4-Amino-3-nitrophenylboronic acid , 96% , 89466-07-9
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB199.20 | In Stock |
|
| 250MG | RMB703.20 | In Stock |
|
| 1G | RMB1281.60 | In Stock |
|
| 5G | RMB6919.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-225 °C (dec.) |
| Boiling point: | 439.5±55.0 °C(Predicted) |
| Density | 1.48±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| pka | 7.17±0.10(Predicted) |
| Appearance | Orange to red Solid |
| InChI | 1S/C6H7BN2O4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3,10-11H,8H2 |
| InChIKey | IRTXQNNJQZNKRP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(cc1[N+]([O-])=O)B(O)O |
| CAS DataBase Reference | 89466-07-9(CAS DataBase Reference) |
Description and Uses
4-Amino-3-nitrophenylboronic acid can be used as a reactant to prepare difluoromethoxy-3-nitrobiphenyl-4-amine by coupling with 1-bromo-2-(difluoromethoxy)-benzene in the presence of a palladium catalyst.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
