BD5039241
4-Amino-3-nitrophenylboronicAcidPinacolEster , 98% , 833486-94-5
Synonym(s):
2-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
CAS NO.:833486-94-5
Empirical Formula: C12H17BN2O4
Molecular Weight: 264.09
MDL number: MFCD06795680
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB72.80 | In Stock |
|
| 250mg | RMB100.80 | In Stock |
|
| 1g | RMB198.40 | In Stock |
|
| 5g | RMB980.00 | In Stock |
|
| 25g | RMB4209.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157.1-172.4 °C |
| Boiling point: | 404.0±35.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | -0.76±0.56(Predicted) |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C12H17BN2O4/c1-11(2)12(3,4)19-13(18-11)8-5-6-9(14)10(7-8)15(16)17/h5-7H,14H2,1-4H3 |
| InChIKey | QOYJKGGBFKVKDP-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 833486-94-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






