A1300312
2-Bromo-5-Acetylpyridine , 97% , 139042-59-4
Synonym(s):
3-Acetyl-6-bromopyridine
CAS NO.：139042-59-4
Empirical Formula: C7H6BrNO
Molecular Weight: 200.03
MDL number: MFCD04974527
EINECS: 625-249-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB54.40 | In Stock |
|
| 5G | RMB200.80 | In Stock |
|
| 25G | RMB812.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-128 °C (lit.) |
| Boiling point: | 304.7±27.0 °C(Predicted) |
| Density | 1.534±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.01±0.10(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C7H6BrNO/c1-5(10)6-2-3-7(8)9-4-6/h2-4H,1H3 |
| InChIKey | MUKKGHQBUKOMTD-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(Br)N=C1)C |
| CAS DataBase Reference | 139042-59-4(CAS DataBase Reference) |
Description and Uses
5-Acetyl-2-bromopyridine is used as biochemical reagent and organic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
