A1306712
Boc-Thr(tBu)-OH , 99% , 13734-40-2
Synonym(s):
(S)-3-tert-Butoxy-2-tert-butoxycarbonylamino-butyric acid;Boc-O-tert-butyl-L -threonine;Boc-Thr(tBu)-OH;N-α-t.-Boc-O-t.-butyl-L-threonine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB35.20 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C |
| Boiling point: | 391.3±37.0 °C(Predicted) |
| Density | 1.070±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMF. |
| form | Solid |
| pka | 3.53±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +3.6±0.5°, c = 2% in DMF |
| BRN | 4454820 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H25NO5/c1-8(18-12(2,3)4)9(10(15)16)14-11(17)19-13(5,6)7/h8-9H,1-7H3,(H,14,17)(H,15,16)/t8-,9+/m1/s1 |
| InChIKey | LKRXXARJBFBMCE-BDAKNGLRSA-N |
| SMILES | C[C@@H](OC(C)(C)C)[C@H](NC(=O)OC(C)(C)C)C(O)=O |
| CAS DataBase Reference | 13734-40-2(CAS DataBase Reference) |
Description and Uses
N-Boc-O-tert-butyl-L-threonine is used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| Storage Class | 11 - Combustible Solids |







