A1308012
Boc-3-(2-naphthyl)-D-alanine , 99% , 76985-10-9
Synonym(s):
Boc-3-(2-naphthyl)-D -alanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB76.00 | In Stock |
|
| 5G | RMB242.40 | In Stock |
|
| 25G | RMB1004.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-95 °C(lit.) |
| Boiling point: | 454.92°C (rough estimate) |
| alpha | -45 º (c=1% in ethanol) |
| Density | 1.2164 (rough estimate) |
| refractive index | 1.5740 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Sparingly), Ethanol (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.88±0.30(Predicted) |
| color | White |
| optical activity | [α]20/D 45±2°, c = 1% in ethanol |
| BRN | 4200660 |
| Major Application | peptide synthesis |
| InChI | 1S/C18H21NO4/c1-18(2,3)23-17(22)19-15(16(20)21)11-12-8-9-13-6-4-5-7-14(13)10-12/h4-10,15H,11H2,1-3H3,(H,19,22)(H,20,21)/t15-/m1/s1 |
| InChIKey | URKWHOVNPHQQTM-OAHLLOKOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc2ccccc2c1)C(O)=O |
| CAS DataBase Reference | 76985-10-9(CAS DataBase Reference) |
Description and Uses
Boc-3-(2-Naphthyl)-D-alanine is a reagent in Lanreotide trisulfide synthesis and somatostatin receptor binding activity. Reagent in the preparation by coupling and structure-activity relationships of arginine containing tripeptides as MC4 receptor ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







