A1311812
BOC-L-Homophenylalanine , 98% , 100564-78-1
Synonym(s):
(S)-2-(Boc-amino)-4-phenylbutyric acid;Boc-L -homophenylalanine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB32.00 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB179.20 | In Stock |
|
| 100G | RMB495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-80 °C |
| Boiling point: | 439.6±38.0 °C(Predicted) |
| Density | 1.139 |
| storage temp. | 2-8°C |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| pka | 3.95±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +6.5±1°, c = 2% in ethanol |
| BRN | 3653506 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C15H21NO4/c1-15(2,3)20-14(19)16-12(13(17)18)10-9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/s3 |
| InChIKey | MCODLPJUFHPVQP-LBPRGKRZSA-N |
| SMILES | [C@@H](C(=O)O)(CCC1=CC=CC=C1)NC(=O)OC(C)(C)C |&1:0,r| |
| CAS DataBase Reference | 100564-78-1(CAS DataBase Reference) |
Description and Uses
N-Boc-L-homophenylalanine is a useful reagent for organic synthesis and other chemical processes. It is used in the preparation of piperidine-containing peptidyl proteasome inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
