A1332512
3,5-Bis(trifluoromethyl)benzonitrile , 98% , 27126-93-8
CAS NO.：27126-93-8
Empirical Formula: C9H3F6N
Molecular Weight: 239.12
MDL number: MFCD00000379
EINECS: 248-240-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB119.20 | In Stock |
|
| 100G | RMB431.20 | In Stock |
|
| 500g | RMB1871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 16°C |
| Boiling point: | 155 °C |
| Density | 1.42 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 163 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| Specific Gravity | 1.420 |
| color | White or Colorless to Almost white or Almost colorless |
| FreezingPoint | 19.0 to 23.0 ℃ |
| BRN | 3552650 |
| InChI | InChI=1S/C9H3F6N/c10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15/h1-3H |
| InChIKey | CZKHHAOIHXHOSR-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 27126-93-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzonitrile, 3,5-bis(trifluoromethyl)-(27126-93-8) |
Description and Uses
3,5-Bis(trifluoromethyl)benzonitrile is a pharmaceutical intermediate compound used in the preparation of Selinexor, a selective nuclear output inhibitor approved for the treatment of relapsed or refractory diffuse large B-cell lymphoma (DLBCL) and multiple myeloma.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H227-H302-H312-H332-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P210e-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-26-28-37/39-36/37/39-36/37-36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
