PRODUCT Properties
| Melting point: | 54-58 |
| Boiling point: | 293.8±35.0 °C(Predicted) |
| Density | 1.936±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -4.99±0.10(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | InChI=1S/C5H2BrClN2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H |
| InChIKey | PTTQIUHVDDBART-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=C1Br |
| CAS DataBase Reference | 5470-17-7(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-chloro-5-nitropyridine is a raw material for the preparation of other organic substances and can be used as a reagent or intermediate component in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H318 |
| Precautionary statements | P280-P301+P310+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-41 |
| Safety Statements | 26-39-45 |
| RIDADR | 2811 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







