A1366912
2-Bromo-6-chloro-4-fluoroaniline , 97% , 201849-14-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB132.80 | In Stock |
|
| 25G | RMB492.80 | In Stock |
|
| 100g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-58 °C (lit.) |
| Boiling point: | 240.7±35.0 °C(Predicted) |
| Density | 1.809±0.06 g/cm3(Predicted) |
| Flash point: | 225 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 0.65±0.10(Predicted) |
| form | Crystalline Powder |
| color | Beige to brown |
| InChI | InChI=1S/C6H4BrClFN/c7-4-1-3(9)2-5(8)6(4)10/h1-2H,10H2 |
| InChIKey | LIBGMUMMWYKJSC-UHFFFAOYSA-N |
| SMILES | C1(N)=C(Cl)C=C(F)C=C1Br |
| CAS DataBase Reference | 201849-14-1(CAS DataBase Reference) |
Description and Uses
2-Bromo-6-chloro-4-fluoroaniline is an amine derivative used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






