A1380312
5-Bromo-4-chloro-2-(methylthio)pyrimidine , 96% , 63810-78-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB40.80 | In Stock |
|
| 1G | RMB93.60 | In Stock |
|
| 5G | RMB303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45.0 to 49.0 °C |
| Boiling point: | 309.5±22.0 °C(Predicted) |
| Density | 1.83±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.97±0.29(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C5H4BrClN2S/c1-10-5-8-2-3(6)4(7)9-5/h2H,1H3 |
| InChIKey | XVRYJQACDDVZEI-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=C(Br)C(Cl)=N1 |
| CAS DataBase Reference | 63810-78-6 |
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Risk Statements | 34-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 2923 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
| HS Code | 29335990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





