A1388212
2-Bromo-3-fluorotoluene , ≥98.0% , 59907-13-0
CAS NO.：59907-13-0
Empirical Formula: C7H6BrF
Molecular Weight: 189.02
MDL number: MFCD08458010
EINECS: 261-982-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB130.40 | In Stock |
|
| 25G | RMB397.60 | In Stock |
|
| 100G | RMB1494.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-123℃ |
| Boiling point: | 187°C |
| Density | 1.503 |
| Flash point: | 76°(169°F) |
| refractive index | 1.5330 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, colourless |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H6BrF/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3 |
| InChIKey | FYCXRRYRNRDSRM-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C)=C1Br |
| CAS DataBase Reference | 59907-13-0(CAS DataBase Reference) |
Description and Uses
2-Bromo-3-fluorotoluene is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 2903998090 |
