A1601912
2-Bromo-3-fluorobenzoic Acid , >96.0% , 132715-69-6
CAS NO.：132715-69-6
Empirical Formula: C7H4BrFO2
Molecular Weight: 219.01
MDL number: MFCD01569398
EINECS: 630-221-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB425.60 | In Stock |
|
| 25g | RMB1868.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-160°C |
| Boiling point: | 292.7±25.0 °C(Predicted) |
| Density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.51±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C7H4BrFO2/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3H,(H,10,11) |
| InChIKey | KQRCBMPPEPNNDS-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1Br |
| CAS DataBase Reference | 132715-69-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39-37 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
