A1570412
2-Bromo-3-fluorobenzotrifluoride , >98.0%(GC) , 104540-42-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB66.40 | In Stock |
|
| 5G | RMB221.60 | In Stock |
|
| 25g | RMB756.80 | In Stock |
|
| 100g | RMB2855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-168° |
| Boiling point: | 167-168 °C (lit.) |
| Density | 1.741 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H3BrF4/c8-6-4(7(10,11)12)2-1-3-5(6)9/h1-3H |
| InChIKey | UERAGXKMOXUWPC-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1Br |
| CAS DataBase Reference | 104540-42-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-36 |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |






