A1420212
BAPTA tetramethyl ester , 95% , 125367-34-2
CAS NO.：125367-34-2
Empirical Formula: C26H32N2O10
Molecular Weight: 532.54
MDL number: MFCD00532664
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1G | RMB132.00 | In Stock |
|
| 5g | RMB464.00 | In Stock |
|
| 25g | RMB1624.00 | In Stock |
|
| 100g | RMB5356.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-95°C |
| Boiling point: | 619.2±55.0 °C(Predicted) |
| Density | 1.267 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | soluble in Acetone, Chloroform, Hot Methanol, Toluene |
| pka | 2.21±0.50(Predicted) |
| form | Powder |
| color | Off-white |
| InChI | InChI=1S/C26H32N2O10/c1-33-23(29)15-27(16-24(30)34-2)19-9-5-7-11-21(19)37-13-14-38-22-12-8-6-10-20(22)28(17-25(31)35-3)18-26(32)36-4/h5-12H,13-18H2,1-4H3 |
| InChIKey | LCPLRKMZANZSAJ-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=CC=C1N(CC(OC)=O)CC(OC)=O)COC1=CC=CC=C1N(CC(OC)=O)CC(OC)=O |
Description and Uses
BAPTA-tetramethyl ester is a lipophilic diester of BAPTA used for inhibition of proteolytic activities of certain metalloproteinases, calpain and TACE.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| HS Code | 2922500090 |
