A1439612
                    Boc-Ile-OSU , ≥98.0%(HPLC) , 3392-08-3
CAS NO.:3392-08-3
Empirical Formula: C15H24N2O6
Molecular Weight: 328.36
MDL number: MFCD00022585
EINECS: 222-231-8
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB48.80 | In Stock | 
                                                 | 
                                        
| 25G | RMB160.00 | In Stock | 
                                                 | 
                                        
| 100g | RMB478.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 103-108 °C | 
                                    
| Density | 1.20±0.1 g/cm3(Predicted) | 
                                    
| storage temp. | Inert atmosphere,Room Temperature | 
                                    
| form | Powder | 
                                    
| pka | 10.81±0.46(Predicted) | 
                                    
| color | White | 
                                    
| InChI | InChI=1S/C15H24N2O6/c1-6-9(2)12(16-14(21)22-15(3,4)5)13(20)23-17-10(18)7-8-11(17)19/h9,12H,6-8H2,1-5H3,(H,16,21)/t9-,12-/m0/s1 | 
                                    
| InChIKey | FATJLEZSGFVHQA-CABZTGNLSA-N | 
                                    
| SMILES | C(ON1C(=O)CCC1=O)(=O)[C@H]([C@@H](C)CC)NC(OC(C)(C)C)=O | 
                                    
| CAS DataBase Reference | 3392-08-3(CAS DataBase Reference) | 
                                    
Description and Uses
Boc-Ile-OSu is used in preparation of Dipeptide Piperidine derivatives for treating or preventing a disease associated with arginase activity.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 | 
| WGK Germany | 3 | 
| F | 3-10-21 | 






